C26H32O5 — CID 91104331
2-(4-prop-2-enoyloxybutoxymethyl)butyl 2-benzylbenzoate (PubChem CID 91104331) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-(4-prop-2-enoyloxybutoxymethyl)butyl 2-benzylbenzoate.
| Compound Name | 2-(4-prop-2-enoyloxybutoxymethyl)butyl 2-benzylbenzoate |
|---|---|
| PubChem CID | 91104331 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-(4-prop-2-enoyloxybutoxymethyl)butyl 2-benzylbenzoate |
| SMILES | C=CC(=O)OCCCCOCC(CC)COC(=O)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C26H32O5/c1-3-21(19-29-16-10-11-17-30-25(27)4-2)20-31-26(28)24-15-9-8-14-23(24)18-22-12-6-5-7-13-22/h4-9,12-15,21H,2-3,10-11,16-20H2,1H3 |
| InChIKey | CILICUVLAWRBSN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|