C27H44NO6+ — CID 161362423
2-(4-prop-2-enoyloxybutoxycarbonyl)benzoic acid;tributylazanium (PubChem CID 161362423) has the molecular formula C27H44NO6+ and a molecular weight of 478.65 g/mol. Its IUPAC name is 2-(4-prop-2-enoyloxybutoxycarbonyl)benzoic acid;tributylazanium.
| Compound Name | 2-(4-prop-2-enoyloxybutoxycarbonyl)benzoic acid;tributylazanium |
|---|---|
| PubChem CID | 161362423 |
| Molecular Formula | C27H44NO6+ |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | 2-(4-prop-2-enoyloxybutoxycarbonyl)benzoic acid;tributylazanium |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccccc1C(=O)O.CCCC[NH+](CCCC)CCCC |
| InChI | InChI=1S/C15H16O6.C12H27N/c1-2-13(16)20-9-5-6-10-21-15(19)12-8-4-3-7-11(12)14(17)18;1-4-7-10-13(11-8-5-2)12-9-6-3/h2-4,7-8H,1,5-6,9-10H2,(H,17,18);4-12H2,1-3H3/p+1 |
| InChIKey | IIIZRZPZFZAAES-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 94.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|