C22H20O6S — CID 177308258
5-(9-oxothioxanthen-2-yl)oxycarbonyloxypentan-2-yl prop-2-enoate (PubChem CID 177308258) has the molecular formula C22H20O6S and a molecular weight of 412.46 g/mol. Its IUPAC name is 5-(9-oxothioxanthen-2-yl)oxycarbonyloxypentan-2-yl prop-2-enoate.
| Compound Name | 5-(9-oxothioxanthen-2-yl)oxycarbonyloxypentan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 177308258 |
| Molecular Formula | C22H20O6S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 5-(9-oxothioxanthen-2-yl)oxycarbonyloxypentan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCOC(=O)Oc1ccc2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C22H20O6S/c1-3-20(23)27-14(2)7-6-12-26-22(25)28-15-10-11-19-17(13-15)21(24)16-8-4-5-9-18(16)29-19/h3-5,8-11,13-14H,1,6-7,12H2,2H3 |
| InChIKey | NGJVLTSNIWZKKY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|