C41H44O15S2 — CID 167351185
(9-oxothioxanthen-4-yl) 3-[2-[4-[1,3-bis(2-prop-2-enoyloxyethoxy)propan-2-yloxy]thiophen-3-yl]oxy-3-(2-prop-2-enoyloxyethoxy)propoxy]propanoate (PubChem CID 167351185) has the molecular formula C41H44O15S2 and a molecular weight of 840.92 g/mol. Its IUPAC name is (9-oxothioxanthen-4-yl) 3-[2-[4-[1,3-bis(2-prop-2-enoyloxyethoxy)propan-2-yloxy]thiophen-3-yl]oxy-3-(2-prop-2-enoyloxyethoxy)propoxy]propanoate.
| Compound Name | (9-oxothioxanthen-4-yl) 3-[2-[4-[1,3-bis(2-prop-2-enoyloxyethoxy)propan-2-yloxy]thiophen-3-yl]oxy-3-(2-prop-2-enoyloxyethoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 167351185 |
| Molecular Formula | C41H44O15S2 |
| Molecular Weight | 840.92 g/mol |
| Exact Mass | 840.21 |
| IUPAC Name | (9-oxothioxanthen-4-yl) 3-[2-[4-[1,3-bis(2-prop-2-enoyloxyethoxy)propan-2-yloxy]thiophen-3-yl]oxy-3-(2-prop-2-enoyloxyethoxy)propoxy]propanoate |
| SMILES | C=CC(=O)OCCOCC(COCCOC(=O)C=C)Oc1cscc1OC(COCCOC(=O)C=C)COCCC(=O)Oc1cccc2c(=O)c3ccccc3sc12 |
| InChI | InChI=1S/C41H44O15S2/c1-4-36(42)51-19-16-48-23-28(22-47-15-14-39(45)56-32-12-9-11-31-40(46)30-10-7-8-13-35(30)58-41(31)32)54-33-26-57-27-34(33)55-29(24-49-17-20-52-37(43)5-2)25-50-18-21-53-38(44)6-3/h4-13,26-29H,1-3,14-25H2 |
| InChIKey | DLLNZBSUMXSTLN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|