2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate

C30H22O2S4 — CID 153327392

IUPAC2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate
SMILESC=CC(=O)OCC(CSc1cccc2c1sc1ccccc12)Sc1cccc2c1sc1ccccc12
InChIInChI=1S/C30H22O2S4/c1-2-28(31)32-17-19(34-27-16-8-12-23-21-10-4-6-14-25(21)36-30(23)27)18-33-26-15-7-11-22-20-9-3-5-13-24(20)35-29(22)26/h2-16,19H,1,17-18H2
InChIKeyIUJLDLQPJWEESQ-UHFFFAOYSA-N
MW542.77 g/mol
LogP9.40
Rot. Bonds8

About 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate

2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate (PubChem CID 153327392) has the molecular formula C30H22O2S4 and a molecular weight of 542.77 g/mol. Its IUPAC name is 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate.

Molecular Properties

Compound Name2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate
PubChem CID153327392
Molecular FormulaC30H22O2S4
Molecular Weight542.77 g/mol
Exact Mass542.05
IUPAC Name2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate
SMILESC=CC(=O)OCC(CSc1cccc2c1sc1ccccc12)Sc1cccc2c1sc1ccccc12
InChIInChI=1S/C30H22O2S4/c1-2-28(31)32-17-19(34-27-16-8-12-23-21-10-4-6-14-25(21)36-30(23)27)18-33-26-15-7-11-22-20-9-3-5-13-24(20)35-29(22)26/h2-16,19H,1,17-18H2
InChIKeyIUJLDLQPJWEESQ-UHFFFAOYSA-N
XLogP9.40
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500542.77
LogP ≤ 59.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate?
The IUPAC name of 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate (CID 153327392) is 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate.
What is the SMILES notation for 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate?
The canonical SMILES for 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate is C=CC(=O)OCC(CSc1cccc2c1sc1ccccc12)Sc1cccc2c1sc1ccccc12.
What is the InChIKey of 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate?
The InChIKey is IUJLDLQPJWEESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22O2S4/c1-2-28(31)32-17-19(34-27-16-8-12-23-21-10-4-6-14-25(21)36-30(23)27)18-33-26-15-7-11-22-20-9-3-5-13-24(20)35-29(22)26/h2-16,19H,1,17-18H2.
What are the key properties of 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate?
2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate has a molecular weight of 542.77 g/mol, XLogP of 9.40, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(dibenzothiophen-4-ylsulfanyl)propyl prop-2-enoate is sourced from PubChem (CID 153327392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).