C30H22O2S4 — CID 146356569
1,1-bis(dibenzothiophen-4-ylsulfanyl)propan-2-yl prop-2-enoate (PubChem CID 146356569) has the molecular formula C30H22O2S4 and a molecular weight of 542.77 g/mol. Its IUPAC name is 1,1-bis(dibenzothiophen-4-ylsulfanyl)propan-2-yl prop-2-enoate.
| Compound Name | 1,1-bis(dibenzothiophen-4-ylsulfanyl)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 146356569 |
| Molecular Formula | C30H22O2S4 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 1,1-bis(dibenzothiophen-4-ylsulfanyl)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(Sc1cccc2c1sc1ccccc12)Sc1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C30H22O2S4/c1-3-27(31)32-18(2)30(35-25-16-8-12-21-19-10-4-6-14-23(19)33-28(21)25)36-26-17-9-13-22-20-11-5-7-15-24(20)34-29(22)26/h3-18,30H,1H2,2H3 |
| InChIKey | IWDSBDIFFMNXDZ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|