C21H24ClNO4S — CID 71272124
4-[4-amino-6-hydroxy-4-(2-hydroxyethyl)hexoxy]-1-chlorothioxanthen-9-one (PubChem CID 71272124) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is 4-[4-amino-6-hydroxy-4-(2-hydroxyethyl)hexoxy]-1-chlorothioxanthen-9-one.
| Compound Name | 4-[4-amino-6-hydroxy-4-(2-hydroxyethyl)hexoxy]-1-chlorothioxanthen-9-one |
|---|---|
| PubChem CID | 71272124 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 4-[4-amino-6-hydroxy-4-(2-hydroxyethyl)hexoxy]-1-chlorothioxanthen-9-one |
| SMILES | NC(CCO)(CCO)CCCOc1ccc(Cl)c2c(=O)c3ccccc3sc12 |
| InChI | InChI=1S/C21H24ClNO4S/c22-15-6-7-16(27-13-3-8-21(23,9-11-24)10-12-25)20-18(15)19(26)14-4-1-2-5-17(14)28-20/h1-2,4-7,24-25H,3,8-13,23H2 |
| InChIKey | PJAMSMPWKJKLBI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|