C50H35BrCl2O5S3 — CID 167670841
1-bromo-4-propoxythioxanthen-9-one;1-chloro-4-ethylthioxanthen-9-one;1-chloro-4-phenoxythioxanthen-9-one (PubChem CID 167670841) has the molecular formula C50H35BrCl2O5S3 and a molecular weight of 962.84 g/mol. Its IUPAC name is 1-bromo-4-propoxythioxanthen-9-one;1-chloro-4-ethylthioxanthen-9-one;1-chloro-4-phenoxythioxanthen-9-one.
| Compound Name | 1-bromo-4-propoxythioxanthen-9-one;1-chloro-4-ethylthioxanthen-9-one;1-chloro-4-phenoxythioxanthen-9-one |
|---|---|
| PubChem CID | 167670841 |
| Molecular Formula | C50H35BrCl2O5S3 |
| Molecular Weight | 962.84 g/mol |
| Exact Mass | 960.02 |
| IUPAC Name | 1-bromo-4-propoxythioxanthen-9-one;1-chloro-4-ethylthioxanthen-9-one;1-chloro-4-phenoxythioxanthen-9-one |
| SMILES | CCCOc1ccc(Br)c2c(=O)c3ccccc3sc12.CCc1ccc(Cl)c2c(=O)c3ccccc3sc12.O=c1c2ccccc2sc2c(Oc3ccccc3)ccc(Cl)c12 |
| InChI | InChI=1S/C19H11ClO2S.C16H13BrO2S.C15H11ClOS/c20-14-10-11-15(22-12-6-2-1-3-7-12)19-17(14)18(21)13-8-4-5-9-16(13)23-19;1-2-9-19-12-8-7-11(17)14-15(18)10-5-3-4-6-13(10)20-16(12)14;1-2-9-7-8-11(16)13-14(17)10-5-3-4-6-12(10)18-15(9)13/h1-11H;3-8H,2,9H2,1H3;3-8H,2H2,1H3 |
| InChIKey | UBUQMLFXOCMKGH-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.84 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|