C31H22BrClO3S2 — CID 175628380
3-(8-bromo-9-oxo-5-propoxythioxanthen-3-yl)-1-chloro-4-ethylthioxanthen-9-one (PubChem CID 175628380) has the molecular formula C31H22BrClO3S2 and a molecular weight of 622.01 g/mol. Its IUPAC name is 3-(8-bromo-9-oxo-5-propoxythioxanthen-3-yl)-1-chloro-4-ethylthioxanthen-9-one.
| Compound Name | 3-(8-bromo-9-oxo-5-propoxythioxanthen-3-yl)-1-chloro-4-ethylthioxanthen-9-one |
|---|---|
| PubChem CID | 175628380 |
| Molecular Formula | C31H22BrClO3S2 |
| Molecular Weight | 622.01 g/mol |
| Exact Mass | 619.99 |
| IUPAC Name | 3-(8-bromo-9-oxo-5-propoxythioxanthen-3-yl)-1-chloro-4-ethylthioxanthen-9-one |
| SMILES | CCCOc1ccc(Br)c2c(=O)c3ccc(-c4cc(Cl)c5c(=O)c6ccccc6sc5c4CC)cc3sc12 |
| InChI | InChI=1S/C31H22BrClO3S2/c1-3-13-36-23-12-11-21(32)26-28(34)19-10-9-16(14-25(19)38-31(23)26)20-15-22(33)27-29(35)18-7-5-6-8-24(18)37-30(27)17(20)4-2/h5-12,14-15H,3-4,13H2,1-2H3 |
| InChIKey | JGZDCMXZMJQPET-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.01 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|