C36H28ClF6O3PS2 — CID 171830970
(4-benzoylphenyl)-(8-chloro-9-oxo-5-propoxythioxanthen-2-yl)-(4-methylphenyl)sulfanium hexafluorophosphate (PubChem CID 171830970) has the molecular formula C36H28ClF6O3PS2 and a molecular weight of 753.17 g/mol. Its IUPAC name is (4-benzoylphenyl)-(8-chloro-9-oxo-5-propoxythioxanthen-2-yl)-(4-methylphenyl)sulfanium hexafluorophosphate.
| Compound Name | (4-benzoylphenyl)-(8-chloro-9-oxo-5-propoxythioxanthen-2-yl)-(4-methylphenyl)sulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 171830970 |
| Molecular Formula | C36H28ClF6O3PS2 |
| Molecular Weight | 753.17 g/mol |
| Exact Mass | 752.08 |
| IUPAC Name | (4-benzoylphenyl)-(8-chloro-9-oxo-5-propoxythioxanthen-2-yl)-(4-methylphenyl)sulfanium hexafluorophosphate |
| SMILES | CCCOc1ccc(Cl)c2c(=O)c3cc([S+](c4ccc(C)cc4)c4ccc(C(=O)c5ccccc5)cc4)ccc3sc12.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C36H28ClO3S2.F6P/c1-3-21-40-31-19-18-30(37)33-35(39)29-22-28(17-20-32(29)41-36(31)33)42(26-13-9-23(2)10-14-26)27-15-11-25(12-16-27)34(38)24-7-5-4-6-8-24;1-7(2,3,4,5)6/h4-20,22H,3,21H2,1-2H3;/q+1;-1 |
| InChIKey | KBTARASRPQUSPG-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.17 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|