C31H20Cl3F6OPS2 — CID 22619594
[4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium hexafluorophosphate (PubChem CID 22619594) has the molecular formula C31H20Cl3F6OPS2 and a molecular weight of 723.96 g/mol. Its IUPAC name is [4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium hexafluorophosphate.
| Compound Name | [4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 22619594 |
| Molecular Formula | C31H20Cl3F6OPS2 |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 721.97 |
| IUPAC Name | [4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=C(c1ccccc1)c1ccc(Sc2ccc([S+](c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C31H20Cl3OS2.F6P/c32-23-7-13-26(14-8-23)37(27-15-9-24(33)10-16-27)28-17-11-25(12-18-28)36-30-19-6-22(20-29(30)34)31(35)21-4-2-1-3-5-21;1-7(2,3,4,5)6/h1-20H;/q+1;-1 |
| InChIKey | WADFCMAIPPEPTK-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|