C31H19Cl4F6OS2Sb — CID 22619570
[4-(4-benzoyl-2,6-dichlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium;hexafluoroantimony(1-) (PubChem CID 22619570) has the molecular formula C31H19Cl4F6OS2Sb and a molecular weight of 849.19 g/mol. Its IUPAC name is [4-(4-benzoyl-2,6-dichlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium;hexafluoroantimony(1-).
| Compound Name | [4-(4-benzoyl-2,6-dichlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 22619570 |
| Molecular Formula | C31H19Cl4F6OS2Sb |
| Molecular Weight | 849.19 g/mol |
| Exact Mass | 845.86 |
| IUPAC Name | [4-(4-benzoyl-2,6-dichlorophenyl)sulfanylphenyl]-bis(4-chlorophenyl)sulfanium;hexafluoroantimony(1-) |
| SMILES | F[Sb-](F)(F)(F)(F)F.O=C(c1ccccc1)c1cc(Cl)c(Sc2ccc([S+](c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C31H19Cl4OS2.6FH.Sb/c32-22-6-12-25(13-7-22)38(26-14-8-23(33)9-15-26)27-16-10-24(11-17-27)37-31-28(34)18-21(19-29(31)35)30(36)20-4-2-1-3-5-20;;;;;;;/h1-19H;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | GKXRAORWEHNXEL-UHFFFAOYSA-H |
| XLogP | 12.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.19 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|