C25H21ClO5S — CID 174796208
1-chloro-4-propoxythioxanthen-9-one;formyl 2-methylbenzoate (PubChem CID 174796208) has the molecular formula C25H21ClO5S and a molecular weight of 468.96 g/mol. Its IUPAC name is 1-chloro-4-propoxythioxanthen-9-one;formyl 2-methylbenzoate.
| Compound Name | 1-chloro-4-propoxythioxanthen-9-one;formyl 2-methylbenzoate |
|---|---|
| PubChem CID | 174796208 |
| Molecular Formula | C25H21ClO5S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 1-chloro-4-propoxythioxanthen-9-one;formyl 2-methylbenzoate |
| SMILES | CCCOc1ccc(Cl)c2c(=O)c3ccccc3sc12.Cc1ccccc1C(=O)OC=O |
| InChI | InChI=1S/C16H13ClO2S.C9H8O3/c1-2-9-19-12-8-7-11(17)14-15(18)10-5-3-4-6-13(10)20-16(12)14;1-7-4-2-3-5-8(7)9(11)12-6-10/h3-8H,2,9H2,1H3;2-6H,1H3 |
| InChIKey | AZDIOIMRVXNJAH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|