C13H10O2S — CID 170237244
4-methyldibenzothiophene-1,3-diol (PubChem CID 170237244) has the molecular formula C13H10O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-methyldibenzothiophene-1,3-diol.
| Compound Name | 4-methyldibenzothiophene-1,3-diol |
|---|---|
| PubChem CID | 170237244 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-methyldibenzothiophene-1,3-diol |
| SMILES | Cc1c(O)cc(O)c2c1sc1ccccc12 |
| InChI | InChI=1S/C13H10O2S/c1-7-9(14)6-10(15)12-8-4-2-3-5-11(8)16-13(7)12/h2-6,14-15H,1H3 |
| InChIKey | FMHVBTGOOVILSX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |