C13H12N2S — CID 68825684
2-methyldibenzothiophene-1,4-diamine (PubChem CID 68825684) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-methyldibenzothiophene-1,4-diamine.
| Compound Name | 2-methyldibenzothiophene-1,4-diamine |
|---|---|
| PubChem CID | 68825684 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-methyldibenzothiophene-1,4-diamine |
| SMILES | Cc1cc(N)c2sc3ccccc3c2c1N |
| InChI | InChI=1S/C13H12N2S/c1-7-6-9(14)13-11(12(7)15)8-4-2-3-5-10(8)16-13/h2-6H,14-15H2,1H3 |
| InChIKey | UHFNQYXHQPJGDI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|