C15H14S — CID 15818020
2,3,4-trimethyldibenzothiophene (PubChem CID 15818020) has the molecular formula C15H14S and a molecular weight of 226.34 g/mol. Its IUPAC name is 2,3,4-trimethyldibenzothiophene.
| Compound Name | 2,3,4-trimethyldibenzothiophene |
|---|---|
| PubChem CID | 15818020 |
| Molecular Formula | C15H14S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,3,4-trimethyldibenzothiophene |
| SMILES | Cc1cc2c(sc3ccccc32)c(C)c1C |
| InChI | InChI=1S/C15H14S/c1-9-8-13-12-6-4-5-7-14(12)16-15(13)11(3)10(9)2/h4-8H,1-3H3 |
| InChIKey | ZKTNZFNAICHKAZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |