C21H12O2S — CID 141183385
12-methyl-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,19-nonaene-17,18-dione (PubChem CID 141183385) has the molecular formula C21H12O2S and a molecular weight of 328.39 g/mol. Its IUPAC name is 12-methyl-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,19-nonaene-17,18-dione.
| Compound Name | 12-methyl-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,19-nonaene-17,18-dione |
|---|---|
| PubChem CID | 141183385 |
| Molecular Formula | C21H12O2S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 12-methyl-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,19-nonaene-17,18-dione |
| SMILES | Cc1c2cc3c(cc2cc2c1sc1ccccc12)=CC(=O)C(=O)C=3 |
| InChI | InChI=1S/C21H12O2S/c1-11-16-7-13-10-19(23)18(22)9-12(13)6-14(16)8-17-15-4-2-3-5-20(15)24-21(11)17/h2-10H,1H3 |
| InChIKey | ASKXFTMOZPZAHG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|