C19H22NOS+ — CID 91587547
(3,4-dimethyl-9-oxothioxanthen-2-yl)methyl-trimethylazanium (PubChem CID 91587547) has the molecular formula C19H22NOS+ and a molecular weight of 312.46 g/mol. Its IUPAC name is (3,4-dimethyl-9-oxothioxanthen-2-yl)methyl-trimethylazanium.
| Compound Name | (3,4-dimethyl-9-oxothioxanthen-2-yl)methyl-trimethylazanium |
|---|---|
| PubChem CID | 91587547 |
| Molecular Formula | C19H22NOS+ |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3,4-dimethyl-9-oxothioxanthen-2-yl)methyl-trimethylazanium |
| SMILES | Cc1c(C[N+](C)(C)C)cc2c(=O)c3ccccc3sc2c1C |
| InChI | InChI=1S/C19H22NOS/c1-12-13(2)19-16(10-14(12)11-20(3,4)5)18(21)15-8-6-7-9-17(15)22-19/h6-10H,11H2,1-5H3/q+1 |
| InChIKey | BJESGRHJCWNJSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|