C31H26OS — CID 174943312
anthracene;2,4-diethylthioxanthen-9-one (PubChem CID 174943312) has the molecular formula C31H26OS and a molecular weight of 446.62 g/mol. Its IUPAC name is anthracene;2,4-diethylthioxanthen-9-one.
| Compound Name | anthracene;2,4-diethylthioxanthen-9-one |
|---|---|
| PubChem CID | 174943312 |
| Molecular Formula | C31H26OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | anthracene;2,4-diethylthioxanthen-9-one |
| SMILES | CCc1cc(CC)c2sc3ccccc3c(=O)c2c1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C17H16OS.C14H10/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)19-17;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h5-10H,3-4H2,1-2H3;1-10H |
| InChIKey | KZIWIXNTUUBESO-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|