About 2-ethylthiophene;2-ethylthioxanthen-9-one
2-ethylthiophene;2-ethylthioxanthen-9-one (PubChem CID 161247685) has the molecular formula C21H20OS2
and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-ethylthiophene;2-ethylthioxanthen-9-one.
Molecular Properties
| Compound Name | 2-ethylthiophene;2-ethylthioxanthen-9-one |
| PubChem CID | 161247685 |
| Molecular Formula | C21H20OS2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-ethylthiophene;2-ethylthioxanthen-9-one |
| SMILES | CCc1ccc2sc3ccccc3c(=O)c2c1.CCc1cccs1 |
| InChI | InChI=1S/C15H12OS.C6H8S/c1-2-10-7-8-14-12(9-10)15(16)11-5-3-4-6-13(11)17-14;1-2-6-4-3-5-7-6/h3-9H,2H2,1H3;3-5H,2H2,1H3 |
| InChIKey | VAVSZCZBZLWGRC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylthiophene;2-ethylthioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylthiophene;2-ethylthioxanthen-9-one?
The IUPAC name of 2-ethylthiophene;2-ethylthioxanthen-9-one (CID 161247685) is 2-ethylthiophene;2-ethylthioxanthen-9-one.
What is the SMILES notation for 2-ethylthiophene;2-ethylthioxanthen-9-one?
The canonical SMILES for 2-ethylthiophene;2-ethylthioxanthen-9-one is CCc1ccc2sc3ccccc3c(=O)c2c1.CCc1cccs1.
What is the InChIKey of 2-ethylthiophene;2-ethylthioxanthen-9-one?
The InChIKey is VAVSZCZBZLWGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12OS.C6H8S/c1-2-10-7-8-14-12(9-10)15(16)11-5-3-4-6-13(11)17-14;1-2-6-4-3-5-7-6/h3-9H,2H2,1H3;3-5H,2H2,1H3.
What are the key properties of 2-ethylthiophene;2-ethylthioxanthen-9-one?
2-ethylthiophene;2-ethylthioxanthen-9-one has a molecular weight of 352.52 g/mol, XLogP of 6.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylthiophene;2-ethylthioxanthen-9-one is sourced from PubChem (CID 161247685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).