C21H28INO2S — CID 173125042
N,N-dimethylethanamine;2-(propan-2-yloxymethyl)thioxanthen-9-one;hydroiodide (PubChem CID 173125042) has the molecular formula C21H28INO2S and a molecular weight of 485.43 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-(propan-2-yloxymethyl)thioxanthen-9-one;hydroiodide.
| Compound Name | N,N-dimethylethanamine;2-(propan-2-yloxymethyl)thioxanthen-9-one;hydroiodide |
|---|---|
| PubChem CID | 173125042 |
| Molecular Formula | C21H28INO2S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N,N-dimethylethanamine;2-(propan-2-yloxymethyl)thioxanthen-9-one;hydroiodide |
| SMILES | CC(C)OCc1ccc2sc3ccccc3c(=O)c2c1.CCN(C)C.I |
| InChI | InChI=1S/C17H16O2S.C4H11N.HI/c1-11(2)19-10-12-7-8-16-14(9-12)17(18)13-5-3-4-6-15(13)20-16;1-4-5(2)3;/h3-9,11H,10H2,1-2H3;4H2,1-3H3;1H |
| InChIKey | VTIDMAXEZQJJKV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|