C39H37O3PS — CID 157074872
2,4-diethylthioxanthen-9-one;diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone (PubChem CID 157074872) has the molecular formula C39H37O3PS and a molecular weight of 616.76 g/mol. Its IUPAC name is 2,4-diethylthioxanthen-9-one;diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | 2,4-diethylthioxanthen-9-one;diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 157074872 |
| Molecular Formula | C39H37O3PS |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 2,4-diethylthioxanthen-9-one;diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCc1cc(CC)c2sc3ccccc3c(=O)c2c1.Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H21O2P.C17H16OS/c1-16-14-17(2)21(18(3)15-16)22(23)25(24,19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)19-17/h4-15H,1-3H3;5-10H,3-4H2,1-2H3 |
| InChIKey | ACVYLYSZBQZLSN-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|