About 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one
2,4-diethyl-9H-thioxanthene;thioxanthen-9-one (PubChem CID 159766903) has the molecular formula C30H26OS2
and a molecular weight of 466.67 g/mol. Its IUPAC name is 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one.
Molecular Properties
| Compound Name | 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one |
| PubChem CID | 159766903 |
| Molecular Formula | C30H26OS2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one |
| SMILES | CCc1cc(CC)c2c(c1)Cc1ccccc1S2.O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C17H18S.C13H8OS/c1-3-12-9-13(4-2)17-15(10-12)11-14-7-5-6-8-16(14)18-17;14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h5-10H,3-4,11H2,1-2H3;1-8H |
| InChIKey | NFPSHOCEASLYOT-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one?
The IUPAC name of 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one (CID 159766903) is 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one.
What is the SMILES notation for 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one?
The canonical SMILES for 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one is CCc1cc(CC)c2c(c1)Cc1ccccc1S2.O=c1c2ccccc2sc2ccccc12.
What is the InChIKey of 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one?
The InChIKey is NFPSHOCEASLYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18S.C13H8OS/c1-3-12-9-13(4-2)17-15(10-12)11-14-7-5-6-8-16(14)18-17;14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h5-10H,3-4,11H2,1-2H3;1-8H.
What are the key properties of 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one?
2,4-diethyl-9H-thioxanthene;thioxanthen-9-one has a molecular weight of 466.67 g/mol, XLogP of 8.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-9H-thioxanthene;thioxanthen-9-one is sourced from PubChem (CID 159766903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).