C19H18S — CID 68570426
2,4-bis(prop-2-enyl)-9H-thioxanthene (PubChem CID 68570426) has the molecular formula C19H18S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2,4-bis(prop-2-enyl)-9H-thioxanthene.
| Compound Name | 2,4-bis(prop-2-enyl)-9H-thioxanthene |
|---|---|
| PubChem CID | 68570426 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2,4-bis(prop-2-enyl)-9H-thioxanthene |
| SMILES | C=CCc1cc(CC=C)c2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C19H18S/c1-3-7-14-11-16(8-4-2)19-17(12-14)13-15-9-5-6-10-18(15)20-19/h3-6,9-12H,1-2,7-8,13H2 |
| InChIKey | DBHWKXOQLDSLBE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|