About sulfamide;9H-thioxanthene
sulfamide;9H-thioxanthene (PubChem CID 174799944) has the molecular formula C13H14N2O2S2
and a molecular weight of 294.40 g/mol. Its IUPAC name is sulfamide;9H-thioxanthene.
Molecular Properties
| Compound Name | sulfamide;9H-thioxanthene |
| PubChem CID | 174799944 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | sulfamide;9H-thioxanthene |
| SMILES | NS(N)(=O)=O.c1ccc2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C13H10S.H4N2O2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-5(2,3)4/h1-8H,9H2;(H4,1,2,3,4) |
| InChIKey | WEUKPNHMDZRZSP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sulfamide;9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfamide;9H-thioxanthene?
The IUPAC name of sulfamide;9H-thioxanthene (CID 174799944) is sulfamide;9H-thioxanthene.
What is the SMILES notation for sulfamide;9H-thioxanthene?
The canonical SMILES for sulfamide;9H-thioxanthene is NS(N)(=O)=O.c1ccc2c(c1)Cc1ccccc1S2.
What is the InChIKey of sulfamide;9H-thioxanthene?
The InChIKey is WEUKPNHMDZRZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.H4N2O2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-5(2,3)4/h1-8H,9H2;(H4,1,2,3,4).
What are the key properties of sulfamide;9H-thioxanthene?
sulfamide;9H-thioxanthene has a molecular weight of 294.40 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfamide;9H-thioxanthene is sourced from PubChem (CID 174799944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).