About dioxotitanium;9H-thioxanthene
dioxotitanium;9H-thioxanthene (PubChem CID 174580063) has the molecular formula C13H10O2STi
and a molecular weight of 278.16 g/mol. Its IUPAC name is dioxotitanium;9H-thioxanthene.
Molecular Properties
| Compound Name | dioxotitanium;9H-thioxanthene |
| PubChem CID | 174580063 |
| Molecular Formula | C13H10O2STi |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | dioxotitanium;9H-thioxanthene |
| SMILES | O=[Ti]=O.c1ccc2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C13H10S.2O.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;;;/h1-8H,9H2;;; |
| InChIKey | NHRNBHNABXFPJG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dioxotitanium;9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxotitanium;9H-thioxanthene?
The IUPAC name of dioxotitanium;9H-thioxanthene (CID 174580063) is dioxotitanium;9H-thioxanthene.
What is the SMILES notation for dioxotitanium;9H-thioxanthene?
The canonical SMILES for dioxotitanium;9H-thioxanthene is O=[Ti]=O.c1ccc2c(c1)Cc1ccccc1S2.
What is the InChIKey of dioxotitanium;9H-thioxanthene?
The InChIKey is NHRNBHNABXFPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.2O.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;;;/h1-8H,9H2;;;.
What are the key properties of dioxotitanium;9H-thioxanthene?
dioxotitanium;9H-thioxanthene has a molecular weight of 278.16 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxotitanium;9H-thioxanthene is sourced from PubChem (CID 174580063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).