About 1H-azepine;9H-thioxanthene
1H-azepine;9H-thioxanthene (PubChem CID 174889016) has the molecular formula C19H17NS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 1H-azepine;9H-thioxanthene.
Molecular Properties
| Compound Name | 1H-azepine;9H-thioxanthene |
| PubChem CID | 174889016 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1H-azepine;9H-thioxanthene |
| SMILES | C1=CC=CNC=C1.c1ccc2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C13H10S.C6H7N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-4-6-7-5-3-1/h1-8H,9H2;1-7H |
| InChIKey | BWSDAZDHIPTBCO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-azepine;9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;9H-thioxanthene?
The IUPAC name of 1H-azepine;9H-thioxanthene (CID 174889016) is 1H-azepine;9H-thioxanthene.
What is the SMILES notation for 1H-azepine;9H-thioxanthene?
The canonical SMILES for 1H-azepine;9H-thioxanthene is C1=CC=CNC=C1.c1ccc2c(c1)Cc1ccccc1S2.
What is the InChIKey of 1H-azepine;9H-thioxanthene?
The InChIKey is BWSDAZDHIPTBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.C6H7N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-4-6-7-5-3-1/h1-8H,9H2;1-7H.
What are the key properties of 1H-azepine;9H-thioxanthene?
1H-azepine;9H-thioxanthene has a molecular weight of 291.42 g/mol, XLogP of 4.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;9H-thioxanthene is sourced from PubChem (CID 174889016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).