About copper;9H-thioxanthene
copper;9H-thioxanthene (PubChem CID 174315063) has the molecular formula C13H10CuS
and a molecular weight of 261.84 g/mol. Its IUPAC name is copper;9H-thioxanthene.
Molecular Properties
| Compound Name | copper;9H-thioxanthene |
| PubChem CID | 174315063 |
| Molecular Formula | C13H10CuS |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | copper;9H-thioxanthene |
| SMILES | [Cu].c1ccc2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C13H10S.Cu/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-8H,9H2; |
| InChIKey | LIHYFFYMGSLCDS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze copper;9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;9H-thioxanthene?
The IUPAC name of copper;9H-thioxanthene (CID 174315063) is copper;9H-thioxanthene.
What is the SMILES notation for copper;9H-thioxanthene?
The canonical SMILES for copper;9H-thioxanthene is [Cu].c1ccc2c(c1)Cc1ccccc1S2.
What is the InChIKey of copper;9H-thioxanthene?
The InChIKey is LIHYFFYMGSLCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.Cu/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-8H,9H2;.
What are the key properties of copper;9H-thioxanthene?
copper;9H-thioxanthene has a molecular weight of 261.84 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;9H-thioxanthene is sourced from PubChem (CID 174315063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).