C14H16 — CID 10511708
2-methyl-3-prop-2-enyl-1,4-dihydronaphthalene (PubChem CID 10511708) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enyl-1,4-dihydronaphthalene.
| Compound Name | 2-methyl-3-prop-2-enyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 10511708 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-methyl-3-prop-2-enyl-1,4-dihydronaphthalene |
| SMILES | C=CCC1=C(C)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H16/c1-3-6-12-10-14-8-5-4-7-13(14)9-11(12)2/h3-5,7-8H,1,6,9-10H2,2H3 |
| InChIKey | RIDZBMJHKNVPGG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|