C18H13ClS — CID 13248498
6-(chloromethyl)-1-methylnaphtho[1,2-b][1]benzothiole (PubChem CID 13248498) has the molecular formula C18H13ClS and a molecular weight of 296.82 g/mol. Its IUPAC name is 6-(chloromethyl)-1-methylnaphtho[1,2-b][1]benzothiole.
| Compound Name | 6-(chloromethyl)-1-methylnaphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 13248498 |
| Molecular Formula | C18H13ClS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 6-(chloromethyl)-1-methylnaphtho[1,2-b][1]benzothiole |
| SMILES | Cc1cccc2cc(CCl)c3c4ccccc4sc3c12 |
| InChI | InChI=1S/C18H13ClS/c1-11-5-4-6-12-9-13(10-19)17-14-7-2-3-8-15(14)20-18(17)16(11)12/h2-9H,10H2,1H3 |
| InChIKey | BKQANPFEUOTJGA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|