C18H14OS — CID 13248494
(8-methylnaphtho[1,2-b][1]benzothiol-6-yl)methanol (PubChem CID 13248494) has the molecular formula C18H14OS and a molecular weight of 278.38 g/mol. Its IUPAC name is (8-methylnaphtho[1,2-b][1]benzothiol-6-yl)methanol.
| Compound Name | (8-methylnaphtho[1,2-b][1]benzothiol-6-yl)methanol |
|---|---|
| PubChem CID | 13248494 |
| Molecular Formula | C18H14OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (8-methylnaphtho[1,2-b][1]benzothiol-6-yl)methanol |
| SMILES | Cc1ccc2sc3c4ccccc4cc(CO)c3c2c1 |
| InChI | InChI=1S/C18H14OS/c1-11-6-7-16-15(8-11)17-13(10-19)9-12-4-2-3-5-14(12)18(17)20-16/h2-9,19H,10H2,1H3 |
| InChIKey | GZJBWZOBSZNYKW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |