C18H12O2S — CID 12813835
9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid (PubChem CID 12813835) has the molecular formula C18H12O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid.
| Compound Name | 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid |
|---|---|
| PubChem CID | 12813835 |
| Molecular Formula | C18H12O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid |
| SMILES | Cc1ccc2c(c1)sc1c3ccccc3cc(C(=O)O)c21 |
| InChI | InChI=1S/C18H12O2S/c1-10-6-7-13-15(8-10)21-17-12-5-3-2-4-11(12)9-14(16(13)17)18(19)20/h2-9H,1H3,(H,19,20) |
| InChIKey | YUZSKTUKLQTMRP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |