9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid

C18H12O2S — CID 12813835

IUPAC9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid
SMILESCc1ccc2c(c1)sc1c3ccccc3cc(C(=O)O)c21
InChIInChI=1S/C18H12O2S/c1-10-6-7-13-15(8-10)21-17-12-5-3-2-4-11(12)9-14(16(13)17)18(19)20/h2-9H,1H3,(H,19,20)
InChIKeyYUZSKTUKLQTMRP-UHFFFAOYSA-N
MW292.36 g/mol
LogP5.21
Rot. Bonds1

About 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid

9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid (PubChem CID 12813835) has the molecular formula C18H12O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid.

Molecular Properties

Compound Name9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid
PubChem CID12813835
Molecular FormulaC18H12O2S
Molecular Weight292.36 g/mol
Exact Mass292.06
IUPAC Name9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid
SMILESCc1ccc2c(c1)sc1c3ccccc3cc(C(=O)O)c21
InChIInChI=1S/C18H12O2S/c1-10-6-7-13-15(8-10)21-17-12-5-3-2-4-11(12)9-14(16(13)17)18(19)20/h2-9H,1H3,(H,19,20)
InChIKeyYUZSKTUKLQTMRP-UHFFFAOYSA-N
XLogP5.21
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500292.36
LogP ≤ 55.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid?
The IUPAC name of 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid (CID 12813835) is 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid.
What is the SMILES notation for 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid?
The canonical SMILES for 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid is Cc1ccc2c(c1)sc1c3ccccc3cc(C(=O)O)c21.
What is the InChIKey of 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid?
The InChIKey is YUZSKTUKLQTMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2S/c1-10-6-7-13-15(8-10)21-17-12-5-3-2-4-11(12)9-14(16(13)17)18(19)20/h2-9H,1H3,(H,19,20).
What are the key properties of 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid?
9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid has a molecular weight of 292.36 g/mol, XLogP of 5.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylnaphtho[1,2-b][1]benzothiole-6-carboxylic acid is sourced from PubChem (CID 12813835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).