About 3-chloro-2,4-dimethyl-1-benzothiophene;ethane
3-chloro-2,4-dimethyl-1-benzothiophene;ethane (PubChem CID 143520176) has the molecular formula C12H15ClS
and a molecular weight of 226.77 g/mol. Its IUPAC name is 3-chloro-2,4-dimethyl-1-benzothiophene;ethane.
Molecular Properties
| Compound Name | 3-chloro-2,4-dimethyl-1-benzothiophene;ethane |
| PubChem CID | 143520176 |
| Molecular Formula | C12H15ClS |
| Molecular Weight | 226.77 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-chloro-2,4-dimethyl-1-benzothiophene;ethane |
| SMILES | CC.Cc1sc2cccc(C)c2c1Cl |
| InChI | InChI=1S/C10H9ClS.C2H6/c1-6-4-3-5-8-9(6)10(11)7(2)12-8;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | SCWSDGBSDVSBSI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2,4-dimethyl-1-benzothiophene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,4-dimethyl-1-benzothiophene;ethane?
The IUPAC name of 3-chloro-2,4-dimethyl-1-benzothiophene;ethane (CID 143520176) is 3-chloro-2,4-dimethyl-1-benzothiophene;ethane.
What is the SMILES notation for 3-chloro-2,4-dimethyl-1-benzothiophene;ethane?
The canonical SMILES for 3-chloro-2,4-dimethyl-1-benzothiophene;ethane is CC.Cc1sc2cccc(C)c2c1Cl.
What is the InChIKey of 3-chloro-2,4-dimethyl-1-benzothiophene;ethane?
The InChIKey is SCWSDGBSDVSBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClS.C2H6/c1-6-4-3-5-8-9(6)10(11)7(2)12-8;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of 3-chloro-2,4-dimethyl-1-benzothiophene;ethane?
3-chloro-2,4-dimethyl-1-benzothiophene;ethane has a molecular weight of 226.77 g/mol, XLogP of 5.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,4-dimethyl-1-benzothiophene;ethane is sourced from PubChem (CID 143520176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).