C14H14N2+2 — CID 143965804
5a,11,11a,12-tetrahydroindolizino[2,3-b]indolizine-5,6-diium (PubChem CID 143965804) has the molecular formula C14H14N2+2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5a,11,11a,12-tetrahydroindolizino[2,3-b]indolizine-5,6-diium.
| Compound Name | 5a,11,11a,12-tetrahydroindolizino[2,3-b]indolizine-5,6-diium |
|---|---|
| PubChem CID | 143965804 |
| Molecular Formula | C14H14N2+2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 5a,11,11a,12-tetrahydroindolizino[2,3-b]indolizine-5,6-diium |
| SMILES | c1cc[n+]2c(c1)CC1Cc3cccc[n+]3C12 |
| InChI | InChI=1S/C14H14N2/c1-3-7-15-12(5-1)9-11-10-13-6-2-4-8-16(13)14(11)15/h1-8,11,14H,9-10H2/q+2 |
| InChIKey | YJHHGUUFQBDVLG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|