C23H20N2+2 — CID 158151254
23,24-diazoniaheptacyclo[11.10.1.11,8.02,7.017,24.018,23.011,25]pentacosa-2,4,6,13(24),14,16,18,20,22-nonaene (PubChem CID 158151254) has the molecular formula C23H20N2+2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 23,24-diazoniaheptacyclo[11.10.1.11,8.02,7.017,24.018,23.011,25]pentacosa-2,4,6,13(24),14,16,18,20,22-nonaene.
| Compound Name | 23,24-diazoniaheptacyclo[11.10.1.11,8.02,7.017,24.018,23.011,25]pentacosa-2,4,6,13(24),14,16,18,20,22-nonaene |
|---|---|
| PubChem CID | 158151254 |
| Molecular Formula | C23H20N2+2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 23,24-diazoniaheptacyclo[11.10.1.11,8.02,7.017,24.018,23.011,25]pentacosa-2,4,6,13(24),14,16,18,20,22-nonaene |
| SMILES | c1ccc2c(c1)C1CCC3Cc4cccc5[n+]4C2(C31)[n+]1ccccc1-5 |
| InChI | InChI=1S/C23H20N2/c1-2-8-19-17(7-1)18-12-11-15-14-16-6-5-10-21-20-9-3-4-13-24(20)23(19,22(15)18)25(16)21/h1-10,13,15,18,22H,11-12,14H2/q+2 |
| InChIKey | IFIKWLXJDCAQSV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|