C22H20N2S+2 — CID 58687393
2-(2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-1-yl)ethynyl-trimethyl-λ4-sulfane (PubChem CID 58687393) has the molecular formula C22H20N2S+2 and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-(2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-1-yl)ethynyl-trimethyl-λ4-sulfane.
| Compound Name | 2-(2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-1-yl)ethynyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 58687393 |
| Molecular Formula | C22H20N2S+2 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-1-yl)ethynyl-trimethyl-λ4-sulfane |
| SMILES | CS(C)(C)C#CC12c3ccccc3-c3cccc([n+]31)-c1cccc[n+]12 |
| InChI | InChI=1S/C22H20N2S/c1-25(2,3)16-14-22-18-10-5-4-9-17(18)19-12-8-13-21(24(19)22)20-11-6-7-15-23(20)22/h4-13,15H,1-3H3/q+2 |
| InChIKey | MHVXZCSUGTUGOM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|