C19H26N2+2 — CID 159940627
8,8-ditert-butyl-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 159940627) has the molecular formula C19H26N2+2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 8,8-ditert-butyl-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8,8-ditert-butyl-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 159940627 |
| Molecular Formula | C19H26N2+2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 8,8-ditert-butyl-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC(C)(C)C1(C(C)(C)C)[n+]2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C19H26N2/c1-17(2,3)19(18(4,5)6)20-13-9-7-11-15(20)16-12-8-10-14-21(16)19/h7-14H,1-6H3/q+2 |
| InChIKey | BUECUPJMHWCANA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|