C32H46N+ — CID 123584089
12,12-bis(2,2-dimethylpropyl)-6,7-diethyl-6,7-dimethylindeno[2,1-a]quinolizin-5-ium (PubChem CID 123584089) has the molecular formula C32H46N+ and a molecular weight of 444.73 g/mol. Its IUPAC name is 12,12-bis(2,2-dimethylpropyl)-6,7-diethyl-6,7-dimethylindeno[2,1-a]quinolizin-5-ium.
| Compound Name | 12,12-bis(2,2-dimethylpropyl)-6,7-diethyl-6,7-dimethylindeno[2,1-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123584089 |
| Molecular Formula | C32H46N+ |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 12,12-bis(2,2-dimethylpropyl)-6,7-diethyl-6,7-dimethylindeno[2,1-a]quinolizin-5-ium |
| SMILES | CCC1(C)C2=C(c3cccc[n+]3C1(C)CC)C(CC(C)(C)C)(CC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C32H46N/c1-11-30(9)26-23-17-13-14-18-24(23)32(21-28(3,4)5,22-29(6,7)8)27(26)25-19-15-16-20-33(25)31(30,10)12-2/h13-20H,11-12,21-22H2,1-10H3/q+1 |
| InChIKey | NEZHZYIZENZSCD-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|