C19H23FN+ — CID 123834920
6,7-diethyl-10-fluoro-6,7-dimethylbenzo[a]quinolizin-5-ium (PubChem CID 123834920) has the molecular formula C19H23FN+ and a molecular weight of 284.40 g/mol. Its IUPAC name is 6,7-diethyl-10-fluoro-6,7-dimethylbenzo[a]quinolizin-5-ium.
| Compound Name | 6,7-diethyl-10-fluoro-6,7-dimethylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123834920 |
| Molecular Formula | C19H23FN+ |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 6,7-diethyl-10-fluoro-6,7-dimethylbenzo[a]quinolizin-5-ium |
| SMILES | CCC1(C)c2ccc(F)cc2-c2cccc[n+]2C1(C)CC |
| InChI | InChI=1S/C19H23FN/c1-5-18(3)16-11-10-14(20)13-15(16)17-9-7-8-12-21(17)19(18,4)6-2/h7-13H,5-6H2,1-4H3/q+1 |
| InChIKey | ICBVISKHSZNCOS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|