C47H50N3+ — CID 123667283
10-[3-[3-(5-butyl-3-pyridinyl)-5-pyridin-3-ylphenyl]phenyl]-6,7-diethyl-7-methyl-6-propylbenzo[a]quinolizin-5-ium (PubChem CID 123667283) has the molecular formula C47H50N3+ and a molecular weight of 656.94 g/mol. Its IUPAC name is 10-[3-[3-(5-butyl-3-pyridinyl)-5-pyridin-3-ylphenyl]phenyl]-6,7-diethyl-7-methyl-6-propylbenzo[a]quinolizin-5-ium.
| Compound Name | 10-[3-[3-(5-butyl-3-pyridinyl)-5-pyridin-3-ylphenyl]phenyl]-6,7-diethyl-7-methyl-6-propylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123667283 |
| Molecular Formula | C47H50N3+ |
| Molecular Weight | 656.94 g/mol |
| Exact Mass | 656.40 |
| IUPAC Name | 10-[3-[3-(5-butyl-3-pyridinyl)-5-pyridin-3-ylphenyl]phenyl]-6,7-diethyl-7-methyl-6-propylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1cncc(-c2cc(-c3cccnc3)cc(-c3cccc(-c4ccc5c(c4)-c4cccc[n+]4C(CC)(CCC)C5(C)CC)c3)c2)c1 |
| InChI | InChI=1S/C47H50N3/c1-6-10-15-34-25-42(33-49-31-34)41-28-39(27-40(29-41)38-18-14-23-48-32-38)36-17-13-16-35(26-36)37-20-21-44-43(30-37)45-19-11-12-24-50(45)47(9-4,22-7-2)46(44,5)8-3/h11-14,16-21,23-33H,6-10,15,22H2,1-5H3/q+1 |
| InChIKey | ZAAYJZMROAOSHL-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.94 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|