C44H40NS2+ — CID 123461105
2-[3-(3,5-dithiophen-2-ylphenyl)phenyl]-5,6,6-triethyl-5-methylisoquinolino[3,2-a]isoquinolin-7-ium (PubChem CID 123461105) has the molecular formula C44H40NS2+ and a molecular weight of 646.95 g/mol. Its IUPAC name is 2-[3-(3,5-dithiophen-2-ylphenyl)phenyl]-5,6,6-triethyl-5-methylisoquinolino[3,2-a]isoquinolin-7-ium.
| Compound Name | 2-[3-(3,5-dithiophen-2-ylphenyl)phenyl]-5,6,6-triethyl-5-methylisoquinolino[3,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123461105 |
| Molecular Formula | C44H40NS2+ |
| Molecular Weight | 646.95 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 2-[3-(3,5-dithiophen-2-ylphenyl)phenyl]-5,6,6-triethyl-5-methylisoquinolino[3,2-a]isoquinolin-7-ium |
| SMILES | CCC1(C)c2ccc(-c3cccc(-c4cc(-c5cccs5)cc(-c5cccs5)c4)c3)cc2-c2cc3ccccc3c[n+]2C1(CC)CC |
| InChI | InChI=1S/C44H40NS2/c1-5-43(4)39-20-19-33(27-38(39)40-28-32-13-8-9-14-34(32)29-45(40)44(43,6-2)7-3)30-15-10-16-31(23-30)35-24-36(41-17-11-21-46-41)26-37(25-35)42-18-12-22-47-42/h8-29H,5-7H2,1-4H3/q+1 |
| InChIKey | JRCNWSIDLGFVIJ-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.95 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|