C50H50N3+ — CID 123570013
2-[3-[4-(3-butylphenyl)-6-phenylpyrimidin-2-yl]phenyl]-5,6,6-triethyl-5-methylisoquinolino[1,2-a]isoquinolin-7-ium (PubChem CID 123570013) has the molecular formula C50H50N3+ and a molecular weight of 692.97 g/mol. Its IUPAC name is 2-[3-[4-(3-butylphenyl)-6-phenylpyrimidin-2-yl]phenyl]-5,6,6-triethyl-5-methylisoquinolino[1,2-a]isoquinolin-7-ium.
| Compound Name | 2-[3-[4-(3-butylphenyl)-6-phenylpyrimidin-2-yl]phenyl]-5,6,6-triethyl-5-methylisoquinolino[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123570013 |
| Molecular Formula | C50H50N3+ |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.40 |
| IUPAC Name | 2-[3-[4-(3-butylphenyl)-6-phenylpyrimidin-2-yl]phenyl]-5,6,6-triethyl-5-methylisoquinolino[1,2-a]isoquinolin-7-ium |
| SMILES | CCCCc1cccc(-c2cc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)-c4c6ccccc6cc[n+]4C(CC)(CC)C5(C)CC)c3)n2)c1 |
| InChI | InChI=1S/C50H50N3/c1-6-10-18-35-19-16-24-40(31-35)46-34-45(37-21-12-11-13-22-37)51-48(52-46)41-25-17-23-38(32-41)39-27-28-44-43(33-39)47-42-26-15-14-20-36(42)29-30-53(47)50(8-3,9-4)49(44,5)7-2/h11-17,19-34H,6-10,18H2,1-5H3/q+1 |
| InChIKey | MLBHHYKIWNXYMT-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|