C32H42N+ — CID 123365931
6,6,7-triethyl-7-methyl-10-(2-methyl-5-pentylphenyl)benzo[a]quinolizin-5-ium (PubChem CID 123365931) has the molecular formula C32H42N+ and a molecular weight of 440.70 g/mol. Its IUPAC name is 6,6,7-triethyl-7-methyl-10-(2-methyl-5-pentylphenyl)benzo[a]quinolizin-5-ium.
| Compound Name | 6,6,7-triethyl-7-methyl-10-(2-methyl-5-pentylphenyl)benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123365931 |
| Molecular Formula | C32H42N+ |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 6,6,7-triethyl-7-methyl-10-(2-methyl-5-pentylphenyl)benzo[a]quinolizin-5-ium |
| SMILES | CCCCCc1ccc(C)c(-c2ccc3c(c2)-c2cccc[n+]2C(CC)(CC)C3(C)CC)c1 |
| InChI | InChI=1S/C32H42N/c1-7-11-12-15-25-18-17-24(5)27(22-25)26-19-20-29-28(23-26)30-16-13-14-21-33(30)32(9-3,10-4)31(29,6)8-2/h13-14,16-23H,7-12,15H2,1-6H3/q+1 |
| InChIKey | BFTYDYAXGFTLDT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|