C25H34 — CID 91539590
6-butyl-9,10-diethyl-1,9,10-trimethylphenanthrene (PubChem CID 91539590) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 6-butyl-9,10-diethyl-1,9,10-trimethylphenanthrene.
| Compound Name | 6-butyl-9,10-diethyl-1,9,10-trimethylphenanthrene |
|---|---|
| PubChem CID | 91539590 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 6-butyl-9,10-diethyl-1,9,10-trimethylphenanthrene |
| SMILES | CCCCc1ccc2c(c1)-c1cccc(C)c1C(C)(CC)C2(C)CC |
| InChI | InChI=1S/C25H34/c1-7-10-13-19-15-16-22-21(17-19)20-14-11-12-18(4)23(20)25(6,9-3)24(22,5)8-2/h11-12,14-17H,7-10,13H2,1-6H3 |
| InChIKey | XOISVXVBVPAYIX-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |