C29H40N+ — CID 123514326
2-butyl-6,6,7-triethyl-7,12,12-trimethylindeno[2,1-a]quinolizin-5-ium (PubChem CID 123514326) has the molecular formula C29H40N+ and a molecular weight of 402.65 g/mol. Its IUPAC name is 2-butyl-6,6,7-triethyl-7,12,12-trimethylindeno[2,1-a]quinolizin-5-ium.
| Compound Name | 2-butyl-6,6,7-triethyl-7,12,12-trimethylindeno[2,1-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123514326 |
| Molecular Formula | C29H40N+ |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | 2-butyl-6,6,7-triethyl-7,12,12-trimethylindeno[2,1-a]quinolizin-5-ium |
| SMILES | CCCCc1cc[n+]2c(c1)C1=C(c3ccccc3C1(C)C)C(C)(CC)C2(CC)CC |
| InChI | InChI=1S/C29H40N/c1-8-12-15-21-18-19-30-24(20-21)26-25(28(7,9-2)29(30,10-3)11-4)22-16-13-14-17-23(22)27(26,5)6/h13-14,16-20H,8-12,15H2,1-7H3/q+1 |
| InChIKey | QZOUMTGUSZTPIY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|