C24H34N+ — CID 123759283
4-butyl-1-(1,2-diethyl-2-methylcyclobutyl)-2-phenylpyridin-1-ium (PubChem CID 123759283) has the molecular formula C24H34N+ and a molecular weight of 336.54 g/mol. Its IUPAC name is 4-butyl-1-(1,2-diethyl-2-methylcyclobutyl)-2-phenylpyridin-1-ium.
| Compound Name | 4-butyl-1-(1,2-diethyl-2-methylcyclobutyl)-2-phenylpyridin-1-ium |
|---|---|
| PubChem CID | 123759283 |
| Molecular Formula | C24H34N+ |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 4-butyl-1-(1,2-diethyl-2-methylcyclobutyl)-2-phenylpyridin-1-ium |
| SMILES | CCCCc1cc[n+](C2(CC)CCC2(C)CC)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H34N/c1-5-8-12-20-15-18-25(22(19-20)21-13-10-9-11-14-21)24(7-3)17-16-23(24,4)6-2/h9-11,13-15,18-19H,5-8,12,16-17H2,1-4H3/q+1 |
| InChIKey | ZLIVSPBCUMTUBH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|