C30H40N+ — CID 123775962
5-butyl-10,12-diethyl-8,10,11,12-tetramethyl-13-azoniapentacyclo[9.7.1.02,7.08,19.013,18]nonadeca-1(19),2(7),3,5,13,15,17-heptaene (PubChem CID 123775962) has the molecular formula C30H40N+ and a molecular weight of 414.66 g/mol. Its IUPAC name is 5-butyl-10,12-diethyl-8,10,11,12-tetramethyl-13-azoniapentacyclo[9.7.1.02,7.08,19.013,18]nonadeca-1(19),2(7),3,5,13,15,17-heptaene.
| Compound Name | 5-butyl-10,12-diethyl-8,10,11,12-tetramethyl-13-azoniapentacyclo[9.7.1.02,7.08,19.013,18]nonadeca-1(19),2(7),3,5,13,15,17-heptaene |
|---|---|
| PubChem CID | 123775962 |
| Molecular Formula | C30H40N+ |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 5-butyl-10,12-diethyl-8,10,11,12-tetramethyl-13-azoniapentacyclo[9.7.1.02,7.08,19.013,18]nonadeca-1(19),2(7),3,5,13,15,17-heptaene |
| SMILES | CCCCc1ccc2c(c1)C1(C)CC(C)(CC)C3(C)C1=C2c1cccc[n+]1C3(C)CC |
| InChI | InChI=1S/C30H40N/c1-8-11-14-21-16-17-22-23(19-21)28(5)20-27(4,9-2)30(7)26(28)25(22)24-15-12-13-18-31(24)29(30,6)10-3/h12-13,15-19H,8-11,14,20H2,1-7H3/q+1 |
| InChIKey | GHXJZWZCGUIQOW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|