C33H44N+ — CID 123682053
6,7-diethyl-7-methyl-10-(2-methyl-5-pentylphenyl)-6-propylbenzo[a]quinolizin-5-ium (PubChem CID 123682053) has the molecular formula C33H44N+ and a molecular weight of 454.72 g/mol. Its IUPAC name is 6,7-diethyl-7-methyl-10-(2-methyl-5-pentylphenyl)-6-propylbenzo[a]quinolizin-5-ium.
| Compound Name | 6,7-diethyl-7-methyl-10-(2-methyl-5-pentylphenyl)-6-propylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123682053 |
| Molecular Formula | C33H44N+ |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | 6,7-diethyl-7-methyl-10-(2-methyl-5-pentylphenyl)-6-propylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCCc1ccc(C)c(-c2ccc3c(c2)-c2cccc[n+]2C(CC)(CCC)C3(C)CC)c1 |
| InChI | InChI=1S/C33H44N/c1-7-11-12-15-26-18-17-25(5)28(23-26)27-19-20-30-29(24-27)31-16-13-14-22-34(31)33(10-4,21-8-2)32(30,6)9-3/h13-14,16-20,22-24H,7-12,15,21H2,1-6H3/q+1 |
| InChIKey | YLGLBTKQLXDKPZ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|