C36H41N2+ — CID 123842391
10-(2-butylcarbazol-9-yl)-6,6,7-triethyl-7-methylbenzo[a]quinolizin-5-ium (PubChem CID 123842391) has the molecular formula C36H41N2+ and a molecular weight of 501.74 g/mol. Its IUPAC name is 10-(2-butylcarbazol-9-yl)-6,6,7-triethyl-7-methylbenzo[a]quinolizin-5-ium.
| Compound Name | 10-(2-butylcarbazol-9-yl)-6,6,7-triethyl-7-methylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123842391 |
| Molecular Formula | C36H41N2+ |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | 10-(2-butylcarbazol-9-yl)-6,6,7-triethyl-7-methylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c3ccccc3n(-c3ccc4c(c3)-c3cccc[n+]3C(CC)(CC)C4(C)CC)c2c1 |
| InChI | InChI=1S/C36H41N2/c1-6-10-15-26-19-21-29-28-16-11-12-18-33(28)38(34(29)24-26)27-20-22-31-30(25-27)32-17-13-14-23-37(32)36(8-3,9-4)35(31,5)7-2/h11-14,16-25H,6-10,15H2,1-5H3/q+1 |
| InChIKey | BIRZGQUEIBUHFD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|