C38H38N2+2 — CID 156646962
2-butyl-6,6-diethyl-3'-phenylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] (PubChem CID 156646962) has the molecular formula C38H38N2+2 and a molecular weight of 522.74 g/mol. Its IUPAC name is 2-butyl-6,6-diethyl-3'-phenylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 2-butyl-6,6-diethyl-3'-phenylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 156646962 |
| Molecular Formula | C38H38N2+2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 2-butyl-6,6-diethyl-3'-phenylspiro[benzo[a]quinolizin-5-ium-7,6'-pyrido[2,1-a]isoindol-5-ium] |
| SMILES | CCCCc1cc[n+]2c(c1)-c1ccccc1C1(c3ccccc3-c3ccc(-c4ccccc4)c[n+]31)C2(CC)CC |
| InChI | InChI=1S/C38H38N2/c1-4-7-15-28-24-25-39-36(26-28)32-19-12-14-21-34(32)38(37(39,5-2)6-3)33-20-13-11-18-31(33)35-23-22-30(27-40(35)38)29-16-9-8-10-17-29/h8-14,16-27H,4-7,15H2,1-3H3/q+2 |
| InChIKey | WDNMOUAOFMBPAQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|